C18H23NO — CID 67627522
1,2-diphenylpyrrolidine;ethanol (PubChem CID 67627522) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 1,2-diphenylpyrrolidine;ethanol.
| Compound Name | 1,2-diphenylpyrrolidine;ethanol |
|---|---|
| PubChem CID | 67627522 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 1,2-diphenylpyrrolidine;ethanol |
| SMILES | CCO.c1ccc(C2CCCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17N.C2H6O/c1-3-8-14(9-4-1)16-12-7-13-17(16)15-10-5-2-6-11-15;1-2-3/h1-6,8-11,16H,7,12-13H2;3H,2H2,1H3 |
| InChIKey | BCXHSSNCLUCYMF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |