C31H36N3O4P — CID 10030329
trans-(1R,3S)-3-diethoxyphosphoryl-1-(2-trityl-1,2,4-triazol-3-yl)cyclohexan-1-ol (PubChem CID 10030329) has the molecular formula C31H36N3O4P and a molecular weight of 545.62 g/mol. Its IUPAC name is trans-(1R,3S)-3-diethoxyphosphoryl-1-(2-trityl-1,2,4-triazol-3-yl)cyclohexan-1-ol.
| Compound Name | trans-(1R,3S)-3-diethoxyphosphoryl-1-(2-trityl-1,2,4-triazol-3-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10030329 |
| Molecular Formula | C31H36N3O4P |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | trans-(1R,3S)-3-diethoxyphosphoryl-1-(2-trityl-1,2,4-triazol-3-yl)cyclohexan-1-ol |
| SMILES | CCOP(=O)(OCC)[C@H]1CCC[C@](O)(c2ncnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C31H36N3O4P/c1-3-37-39(36,38-4-2)28-21-14-22-30(35,23-28)29-32-24-33-34(29)31(25-15-8-5-9-16-25,26-17-10-6-11-18-26)27-19-12-7-13-20-27/h5-13,15-20,24,28,35H,3-4,14,21-23H2,1-2H3/t28-,30+/m0/s1 |
| InChIKey | AJOBGSQDQRXZCM-MFMCTBQISA-N |
| XLogP | 6.51 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|