C31H35N3O — CID 141424855
3-(ethylamino)-1-(5-methyl-1-tritylimidazol-4-yl)cyclohexan-1-ol (PubChem CID 141424855) has the molecular formula C31H35N3O and a molecular weight of 465.64 g/mol. Its IUPAC name is 3-(ethylamino)-1-(5-methyl-1-tritylimidazol-4-yl)cyclohexan-1-ol.
| Compound Name | 3-(ethylamino)-1-(5-methyl-1-tritylimidazol-4-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 141424855 |
| Molecular Formula | C31H35N3O |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 3-(ethylamino)-1-(5-methyl-1-tritylimidazol-4-yl)cyclohexan-1-ol |
| SMILES | CCNC1CCCC(O)(c2ncn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2C)C1 |
| InChI | InChI=1S/C31H35N3O/c1-3-32-28-20-13-21-30(35,22-28)29-24(2)34(23-33-29)31(25-14-7-4-8-15-25,26-16-9-5-10-17-26)27-18-11-6-12-19-27/h4-12,14-19,23,28,32,35H,3,13,20-22H2,1-2H3 |
| InChIKey | BCHBITSBOAEKFC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|