C12H22N3O4P — CID 11722505
trans-(1R,3S)-3-diethoxyphosphoryl-1-(1H-1,2,4-triazol-5-yl)cyclohexan-1-ol (PubChem CID 11722505) has the molecular formula C12H22N3O4P and a molecular weight of 303.30 g/mol. Its IUPAC name is trans-(1R,3S)-3-diethoxyphosphoryl-1-(1H-1,2,4-triazol-5-yl)cyclohexan-1-ol.
| Compound Name | trans-(1R,3S)-3-diethoxyphosphoryl-1-(1H-1,2,4-triazol-5-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11722505 |
| Molecular Formula | C12H22N3O4P |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | trans-(1R,3S)-3-diethoxyphosphoryl-1-(1H-1,2,4-triazol-5-yl)cyclohexan-1-ol |
| SMILES | CCOP(=O)(OCC)[C@H]1CCC[C@](O)(c2ncn[nH]2)C1 |
| InChI | InChI=1S/C12H22N3O4P/c1-3-18-20(17,19-4-2)10-6-5-7-12(16,8-10)11-13-9-14-15-11/h9-10,16H,3-8H2,1-2H3,(H,13,14,15)/t10-,12+/m0/s1 |
| InChIKey | PMFZIENRBCVVKV-CMPLNLGQSA-N |
| XLogP | 2.20 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|