C8H13N3O — CID 126978879
1-(2-ethyl-1,2,4-triazol-3-yl)cyclobutan-1-ol (PubChem CID 126978879) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)cyclobutan-1-ol.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 126978879 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)cyclobutan-1-ol |
| SMILES | CCn1ncnc1C1(O)CCC1 |
| InChI | InChI=1S/C8H13N3O/c1-2-11-7(9-6-10-11)8(12)4-3-5-8/h6,12H,2-5H2,1H3 |
| InChIKey | IOXINEAXLQUZBP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |