About (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone
(2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone (PubChem CID 130530173) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone.
Molecular Properties
| Compound Name | (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone |
| PubChem CID | 130530173 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone |
| SMILES | CCn1ncnc1C(=O)C1(C)CCCN1 |
| InChI | InChI=1S/C10H16N4O/c1-3-14-9(11-7-13-14)8(15)10(2)5-4-6-12-10/h7,12H,3-6H2,1-2H3 |
| InChIKey | WUBNMHFHLSDXQY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone?
The IUPAC name of (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone (CID 130530173) is (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone.
What is the SMILES notation for (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone?
The canonical SMILES for (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone is CCn1ncnc1C(=O)C1(C)CCCN1.
What is the InChIKey of (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone?
The InChIKey is WUBNMHFHLSDXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O/c1-3-14-9(11-7-13-14)8(15)10(2)5-4-6-12-10/h7,12H,3-6H2,1-2H3.
What are the key properties of (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone?
(2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone has a molecular weight of 208.26 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1,2,4-triazol-3-yl)-(2-methylpyrrolidin-2-yl)methanone is sourced from PubChem (CID 130530173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).