About 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone
1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone (PubChem CID 130529584) has the molecular formula C6H7F2N3O
and a molecular weight of 175.14 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone.
Analyze 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone (CID 130529584) is 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone is CCn1ncnc1C(=O)C(F)F.
What is the InChIKey of 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone?
The InChIKey is BTECYVPFMWCBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2N3O/c1-2-11-6(9-3-10-11)4(12)5(7)8/h3,5H,2H2,1H3.
What are the key properties of 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone?
1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone has a molecular weight of 175.14 g/mol, XLogP of 0.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethyl-1,2,4-triazol-3-yl)-2,2-difluoroethanone is sourced from PubChem (CID 130529584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).