C11H19N3O — CID 165348695
1-(2-ethyl-1,2,4-triazol-3-yl)heptan-1-one (PubChem CID 165348695) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)heptan-1-one.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)heptan-1-one |
|---|---|
| PubChem CID | 165348695 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)heptan-1-one |
| SMILES | CCCCCCC(=O)c1ncnn1CC |
| InChI | InChI=1S/C11H19N3O/c1-3-5-6-7-8-10(15)11-12-9-13-14(11)4-2/h9H,3-8H2,1-2H3 |
| InChIKey | LQKYAIWHVQJDKY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|