C12H21N3O — CID 115779985
1-(2-propyl-1,2,4-triazol-3-yl)heptan-2-one (PubChem CID 115779985) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(2-propyl-1,2,4-triazol-3-yl)heptan-2-one.
| Compound Name | 1-(2-propyl-1,2,4-triazol-3-yl)heptan-2-one |
|---|---|
| PubChem CID | 115779985 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-(2-propyl-1,2,4-triazol-3-yl)heptan-2-one |
| SMILES | CCCCCC(=O)Cc1ncnn1CCC |
| InChI | InChI=1S/C12H21N3O/c1-3-5-6-7-11(16)9-12-13-10-14-15(12)8-4-2/h10H,3-9H2,1-2H3 |
| InChIKey | BAJXCMISXIUTMJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|