C11H17N3O — CID 103454304
(E)-1-(2-propyl-1,2,4-triazol-3-yl)hex-3-en-2-one (PubChem CID 103454304) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (E)-1-(2-propyl-1,2,4-triazol-3-yl)hex-3-en-2-one.
| Compound Name | (E)-1-(2-propyl-1,2,4-triazol-3-yl)hex-3-en-2-one |
|---|---|
| PubChem CID | 103454304 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (E)-1-(2-propyl-1,2,4-triazol-3-yl)hex-3-en-2-one |
| SMILES | CC/C=C/C(=O)Cc1ncnn1CCC |
| InChI | InChI=1S/C11H17N3O/c1-3-5-6-10(15)8-11-12-9-13-14(11)7-4-2/h5-6,9H,3-4,7-8H2,1-2H3/b6-5+ |
| InChIKey | GABDEQGJHJJOTQ-AATRIKPKSA-N |
| XLogP | 1.77 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|