C10H15N3O — CID 103454303
(E)-1-(2-ethyl-1,2,4-triazol-3-yl)hex-3-en-2-one (PubChem CID 103454303) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is (E)-1-(2-ethyl-1,2,4-triazol-3-yl)hex-3-en-2-one.
| Compound Name | (E)-1-(2-ethyl-1,2,4-triazol-3-yl)hex-3-en-2-one |
|---|---|
| PubChem CID | 103454303 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (E)-1-(2-ethyl-1,2,4-triazol-3-yl)hex-3-en-2-one |
| SMILES | CC/C=C/C(=O)Cc1ncnn1CC |
| InChI | InChI=1S/C10H15N3O/c1-3-5-6-9(14)7-10-11-8-12-13(10)4-2/h5-6,8H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | LHXUSHFOSHCXFA-AATRIKPKSA-N |
| XLogP | 1.38 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|