C10H18N4O — CID 116572036
6-amino-1-(2-ethyl-1,2,4-triazol-3-yl)hexan-2-one (PubChem CID 116572036) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-amino-1-(2-ethyl-1,2,4-triazol-3-yl)hexan-2-one.
| Compound Name | 6-amino-1-(2-ethyl-1,2,4-triazol-3-yl)hexan-2-one |
|---|---|
| PubChem CID | 116572036 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 6-amino-1-(2-ethyl-1,2,4-triazol-3-yl)hexan-2-one |
| SMILES | CCn1ncnc1CC(=O)CCCCN |
| InChI | InChI=1S/C10H18N4O/c1-2-14-10(12-8-13-14)7-9(15)5-3-4-6-11/h8H,2-7,11H2,1H3 |
| InChIKey | KHMJPPDJDMVRDZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|