C8H13N3O2 — CID 103451467
1-(2-ethyl-1,2,4-triazol-3-yl)-3-hydroxybutan-2-one (PubChem CID 103451467) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)-3-hydroxybutan-2-one.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-3-hydroxybutan-2-one |
|---|---|
| PubChem CID | 103451467 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-3-hydroxybutan-2-one |
| SMILES | CCn1ncnc1CC(=O)C(C)O |
| InChI | InChI=1S/C8H13N3O2/c1-3-11-8(9-5-10-11)4-7(13)6(2)12/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | VJJCLIPSLGUFEQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |