About 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one
1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one (PubChem CID 130529478) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one.
Analyze 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one?
The IUPAC name of 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one (CID 130529478) is 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one.
What is the SMILES notation for 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one?
The canonical SMILES for 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one is CCn1ncnc1C(=O)C(C)C.
What is the InChIKey of 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one?
The InChIKey is ZFSVGVMVLSHQEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-4-11-8(9-5-10-11)7(12)6(2)3/h5-6H,4H2,1-3H3.
What are the key properties of 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one?
1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one has a molecular weight of 167.21 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethyl-1,2,4-triazol-3-yl)-2-methylpropan-1-one is sourced from PubChem (CID 130529478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).