C7H14N4O2 — CID 173090839
acetic acid;2-ethyl-N-methyl-1,2,4-triazol-3-amine (PubChem CID 173090839) has the molecular formula C7H14N4O2 and a molecular weight of 186.22 g/mol. Its IUPAC name is acetic acid;2-ethyl-N-methyl-1,2,4-triazol-3-amine.
| Compound Name | acetic acid;2-ethyl-N-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 173090839 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | acetic acid;2-ethyl-N-methyl-1,2,4-triazol-3-amine |
| SMILES | CC(=O)O.CCn1ncnc1NC |
| InChI | InChI=1S/C5H10N4.C2H4O2/c1-3-9-5(6-2)7-4-8-9;1-2(3)4/h4H,3H2,1-2H3,(H,6,7,8);1H3,(H,3,4) |
| InChIKey | QRKXBLJHPGDKEV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |