C6H7N3 — CID 115011095
1-ethyl-5-ethynyl-1,2,4-triazole (PubChem CID 115011095) has the molecular formula C6H7N3 and a molecular weight of 121.14 g/mol. Its IUPAC name is 1-ethyl-5-ethynyl-1,2,4-triazole.
| Compound Name | 1-ethyl-5-ethynyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115011095 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 1-ethyl-5-ethynyl-1,2,4-triazole |
| SMILES | C#Cc1ncnn1CC |
| InChI | InChI=1S/C6H7N3/c1-3-6-7-5-8-9(6)4-2/h1,5H,4H2,2H3 |
| InChIKey | LOALUNCLQOMHBS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|