C4H6ClN3 — CID 45117660
5-chloro-1-ethyl-1,2,4-triazole (PubChem CID 45117660) has the molecular formula C4H6ClN3 and a molecular weight of 131.57 g/mol. Its IUPAC name is 5-chloro-1-ethyl-1,2,4-triazole.
| Compound Name | 5-chloro-1-ethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 45117660 |
| Molecular Formula | C4H6ClN3 |
| Molecular Weight | 131.57 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | 5-chloro-1-ethyl-1,2,4-triazole |
| SMILES | CCn1ncnc1Cl |
| InChI | InChI=1S/C4H6ClN3/c1-2-8-4(5)6-3-7-8/h3H,2H2,1H3 |
| InChIKey | PSFKTYHTVOHGGP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.57 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |