C8H14N4 — CID 174742689
1-ethyl-5-pyrrolidin-1-yl-1,2,4-triazole (PubChem CID 174742689) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 1-ethyl-5-pyrrolidin-1-yl-1,2,4-triazole.
| Compound Name | 1-ethyl-5-pyrrolidin-1-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 174742689 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1-ethyl-5-pyrrolidin-1-yl-1,2,4-triazole |
| SMILES | CCn1ncnc1N1CCCC1 |
| InChI | InChI=1S/C8H14N4/c1-2-12-8(9-7-10-12)11-5-3-4-6-11/h7H,2-6H2,1H3 |
| InChIKey | YDPCELOXVZJOML-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |