C15H25N3O — CID 114819655
8-[(2-ethyl-1,2,4-triazol-3-yl)methyl]spiro[4.5]decan-8-ol (PubChem CID 114819655) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 8-[(2-ethyl-1,2,4-triazol-3-yl)methyl]spiro[4.5]decan-8-ol.
| Compound Name | 8-[(2-ethyl-1,2,4-triazol-3-yl)methyl]spiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 114819655 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 8-[(2-ethyl-1,2,4-triazol-3-yl)methyl]spiro[4.5]decan-8-ol |
| SMILES | CCn1ncnc1CC1(O)CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C15H25N3O/c1-2-18-13(16-12-17-18)11-15(19)9-7-14(8-10-15)5-3-4-6-14/h12,19H,2-11H2,1H3 |
| InChIKey | DYSSYUJWYDOXLH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |