About 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol
3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol (PubChem CID 106823381) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol |
| PubChem CID | 106823381 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol |
| SMILES | CCOC1CC(O)(Cc2ncnn2CC)C1 |
| InChI | InChI=1S/C11H19N3O2/c1-3-14-10(12-8-13-14)7-11(15)5-9(6-11)16-4-2/h8-9,15H,3-7H2,1-2H3 |
| InChIKey | RZAOPEARLAASGI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol?
The IUPAC name of 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol (CID 106823381) is 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol.
What is the SMILES notation for 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol?
The canonical SMILES for 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol is CCOC1CC(O)(Cc2ncnn2CC)C1.
What is the InChIKey of 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol?
The InChIKey is RZAOPEARLAASGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-3-14-10(12-8-13-14)7-11(15)5-9(6-11)16-4-2/h8-9,15H,3-7H2,1-2H3.
What are the key properties of 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol?
3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol has a molecular weight of 225.29 g/mol, XLogP of 0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]cyclobutan-1-ol is sourced from PubChem (CID 106823381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).