C11H16O5 — CID 135036834
cis-(1S,3R)-3-methoxycarbonyl-1,3-dimethyl-2-oxocyclohexane-1-carboxylic acid (PubChem CID 135036834) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is cis-(1S,3R)-3-methoxycarbonyl-1,3-dimethyl-2-oxocyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-methoxycarbonyl-1,3-dimethyl-2-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 135036834 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | cis-(1S,3R)-3-methoxycarbonyl-1,3-dimethyl-2-oxocyclohexane-1-carboxylic acid |
| SMILES | COC(=O)[C@]1(C)CCC[C@](C)(C(=O)O)C1=O |
| InChI | InChI=1S/C11H16O5/c1-10(8(13)14)5-4-6-11(2,7(10)12)9(15)16-3/h4-6H2,1-3H3,(H,13,14)/t10-,11+/m0/s1 |
| InChIKey | ZPXYMAHXKBOZMG-WDEREUQCSA-N |
| XLogP | 1.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|