methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate

C9H16O2 — CID 116842789

IUPACmethyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate
SMILESCCC1(C(=O)OC)CC1(C)C
InChIInChI=1S/C9H16O2/c1-5-9(7(10)11-4)6-8(9,2)3/h5-6H2,1-4H3
InChIKeyXQTNBCIBBINGMI-UHFFFAOYSA-N
MW156.22 g/mol
LogP1.99
Rot. Bonds2

About methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate

methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 116842789) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate
PubChem CID116842789
Molecular FormulaC9H16O2
Molecular Weight156.22 g/mol
Exact Mass156.12
IUPAC Namemethyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate
SMILESCCC1(C(=O)OC)CC1(C)C
InChIInChI=1S/C9H16O2/c1-5-9(7(10)11-4)6-8(9,2)3/h5-6H2,1-4H3
InChIKeyXQTNBCIBBINGMI-UHFFFAOYSA-N
XLogP1.99
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.22
LogP ≤ 51.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate (CID 116842789) is methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate is CCC1(C(=O)OC)CC1(C)C.
What is the InChIKey of methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is XQTNBCIBBINGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-5-9(7(10)11-4)6-8(9,2)3/h5-6H2,1-4H3.
What are the key properties of methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate?
methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 156.22 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-ethyl-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 116842789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).