methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate

C9H17NO2 — CID 129385459

IUPACmethyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate
SMILESCCC1(CC)C[C@@]1(N)C(=O)OC
InChIInChI=1S/C9H17NO2/c1-4-8(5-2)6-9(8,10)7(11)12-3/h4-6,10H2,1-3H3/t9-/m1/s1
InChIKeyYHZLZMMKQONJRQ-SECBINFHSA-N
MW171.24 g/mol
LogP1.07
Rot. Bonds3

About methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate

methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate (PubChem CID 129385459) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate.

Molecular Properties

Compound Namemethyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate
PubChem CID129385459
Molecular FormulaC9H17NO2
Molecular Weight171.24 g/mol
Exact Mass171.13
IUPAC Namemethyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate
SMILESCCC1(CC)C[C@@]1(N)C(=O)OC
InChIInChI=1S/C9H17NO2/c1-4-8(5-2)6-9(8,10)7(11)12-3/h4-6,10H2,1-3H3/t9-/m1/s1
InChIKeyYHZLZMMKQONJRQ-SECBINFHSA-N
XLogP1.07
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.24
LogP ≤ 51.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate?
The IUPAC name of methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate (CID 129385459) is methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate?
The canonical SMILES for methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate is CCC1(CC)C[C@@]1(N)C(=O)OC.
What is the InChIKey of methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate?
The InChIKey is YHZLZMMKQONJRQ-SECBINFHSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-8(5-2)6-9(8,10)7(11)12-3/h4-6,10H2,1-3H3/t9-/m1/s1.
What are the key properties of methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate?
methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate has a molecular weight of 171.24 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S)-1-amino-2,2-diethylcyclopropane-1-carboxylate is sourced from PubChem (CID 129385459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).