C6H7F4NO2 — CID 167715905
methyl 1-amino-2,2,3,3-tetrafluorocyclobutane-1-carboxylate (PubChem CID 167715905) has the molecular formula C6H7F4NO2 and a molecular weight of 201.12 g/mol. Its IUPAC name is methyl 1-amino-2,2,3,3-tetrafluorocyclobutane-1-carboxylate.
| Compound Name | methyl 1-amino-2,2,3,3-tetrafluorocyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 167715905 |
| Molecular Formula | C6H7F4NO2 |
| Molecular Weight | 201.12 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | methyl 1-amino-2,2,3,3-tetrafluorocyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(N)CC(F)(F)C1(F)F |
| InChI | InChI=1S/C6H7F4NO2/c1-13-3(12)4(11)2-5(7,8)6(4,9)10/h2,11H2,1H3 |
| InChIKey | DHJYBBFUCZIVBX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|