methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate

C9H14O3 — CID 45086506

IUPACmethyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate
SMILESCOC(=O)C1(C)CC1(C)C(C)=O
InChIInChI=1S/C9H14O3/c1-6(10)8(2)5-9(8,3)7(11)12-4/h5H2,1-4H3
InChIKeyPIIWXQBFJPXSNB-UHFFFAOYSA-N
MW170.21 g/mol
LogP1.16
Rot. Bonds2

About methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate

methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate (PubChem CID 45086506) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate
PubChem CID45086506
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Namemethyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate
SMILESCOC(=O)C1(C)CC1(C)C(C)=O
InChIInChI=1S/C9H14O3/c1-6(10)8(2)5-9(8,3)7(11)12-4/h5H2,1-4H3
InChIKeyPIIWXQBFJPXSNB-UHFFFAOYSA-N
XLogP1.16
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate (CID 45086506) is methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate is COC(=O)C1(C)CC1(C)C(C)=O.
What is the InChIKey of methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is PIIWXQBFJPXSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-6(10)8(2)5-9(8,3)7(11)12-4/h5H2,1-4H3.
What are the key properties of methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate?
methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 170.21 g/mol, XLogP of 1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-1,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 45086506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).