C17H23NO4 — CID 102337656
methyl (3R,5S)-2-benzyl-5-formyl-5-methyl-3-propyl-1,2-oxazolidine-3-carboxylate (PubChem CID 102337656) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl (3R,5S)-2-benzyl-5-formyl-5-methyl-3-propyl-1,2-oxazolidine-3-carboxylate.
| Compound Name | methyl (3R,5S)-2-benzyl-5-formyl-5-methyl-3-propyl-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102337656 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | methyl (3R,5S)-2-benzyl-5-formyl-5-methyl-3-propyl-1,2-oxazolidine-3-carboxylate |
| SMILES | CCC[C@]1(C(=O)OC)C[C@@](C)(C=O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-4-10-17(15(20)21-3)12-16(2,13-19)22-18(17)11-14-8-6-5-7-9-14/h5-9,13H,4,10-12H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | GWGFJAYHKUEGFL-DLBZAZTESA-N |
| XLogP | 2.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|