C23H21NO5 — CID 101125503
dimethyl 11-benzyl-14-oxa-11-azapentacyclo[6.5.1.02,7.09,13.010,12]tetradeca-2,4,6-triene-10,12-dicarboxylate (PubChem CID 101125503) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is dimethyl 11-benzyl-14-oxa-11-azapentacyclo[6.5.1.02,7.09,13.010,12]tetradeca-2,4,6-triene-10,12-dicarboxylate.
| Compound Name | dimethyl 11-benzyl-14-oxa-11-azapentacyclo[6.5.1.02,7.09,13.010,12]tetradeca-2,4,6-triene-10,12-dicarboxylate |
|---|---|
| PubChem CID | 101125503 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | dimethyl 11-benzyl-14-oxa-11-azapentacyclo[6.5.1.02,7.09,13.010,12]tetradeca-2,4,6-triene-10,12-dicarboxylate |
| SMILES | COC(=O)C12C3C4OC(c5ccccc54)C3C1(C(=O)OC)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H21NO5/c1-27-20(25)22-16-17(19-15-11-7-6-10-14(15)18(16)29-19)23(22,21(26)28-2)24(22)12-13-8-4-3-5-9-13/h3-11,16-19H,12H2,1-2H3 |
| InChIKey | GHDBBKHKGMLBQN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|