C22H21NO4 — CID 135026593
methyl (3R,4S)-2-methyl-3-phenylspiro[1,2-oxazolidine-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4-carboxylate (PubChem CID 135026593) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl (3R,4S)-2-methyl-3-phenylspiro[1,2-oxazolidine-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4-carboxylate.
| Compound Name | methyl (3R,4S)-2-methyl-3-phenylspiro[1,2-oxazolidine-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4-carboxylate |
|---|---|
| PubChem CID | 135026593 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl (3R,4S)-2-methyl-3-phenylspiro[1,2-oxazolidine-5,10'-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene]-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccccc2)N(C)OC12C1C3OC(c4ccccc43)C12 |
| InChI | InChI=1S/C22H21NO4/c1-23-18(12-8-4-3-5-9-12)17(21(24)25-2)22(27-23)15-16(22)20-14-11-7-6-10-13(14)19(15)26-20/h3-11,15-20H,1-2H3/t15?,16?,17-,18+,19?,20?,22?/m1/s1 |
| InChIKey | MKDNPGGMFUQBGJ-MMOZMZTKSA-N |
| XLogP | 3.20 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'} |
|---|