C14H16N2O4 — CID 718060
methyl (1R,9R,13S)-9,10-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate (PubChem CID 718060) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl (1R,9R,13S)-9,10-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate.
| Compound Name | methyl (1R,9R,13S)-9,10-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 718060 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl (1R,9R,13S)-9,10-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-13-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2NC(=O)N(C)[C@]1(C)Oc1ccccc12 |
| InChI | InChI=1S/C14H16N2O4/c1-14-10(12(17)19-3)11(15-13(18)16(14)2)8-6-4-5-7-9(8)20-14/h4-7,10-11H,1-3H3,(H,15,18)/t10-,11+,14-/m1/s1 |
| InChIKey | XWOUIAVSRJHHKP-UHIISALHSA-N |
| XLogP | 1.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |