C18H22N2O5 — CID 6953408
methyl (1R,9S,13S)-6-ethoxy-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate (PubChem CID 6953408) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl (1R,9S,13S)-6-ethoxy-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate.
| Compound Name | methyl (1R,9S,13S)-6-ethoxy-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
|---|---|
| PubChem CID | 6953408 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl (1R,9S,13S)-6-ethoxy-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxylate |
| SMILES | C=CCN1C(=O)N[C@H]2c3cccc(OCC)c3O[C@@]1(C)[C@H]2C(=O)OC |
| InChI | InChI=1S/C18H22N2O5/c1-5-10-20-17(22)19-14-11-8-7-9-12(24-6-2)15(11)25-18(20,3)13(14)16(21)23-4/h5,7-9,13-14H,1,6,10H2,2-4H3,(H,19,22)/t13-,14+,18+/m1/s1 |
| InChIKey | YGPQEPIZTCXYKS-GLJUWKHASA-N |
| XLogP | 2.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|