C11H14N2O — CID 174408490
1,3-dimethyl-2,4-dihydroquinazoline-4-carbaldehyde (PubChem CID 174408490) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dihydroquinazoline-4-carbaldehyde.
| Compound Name | 1,3-dimethyl-2,4-dihydroquinazoline-4-carbaldehyde |
|---|---|
| PubChem CID | 174408490 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1,3-dimethyl-2,4-dihydroquinazoline-4-carbaldehyde |
| SMILES | CN1CN(C)C(C=O)c2ccccc21 |
| InChI | InChI=1S/C11H14N2O/c1-12-8-13(2)11(7-14)9-5-3-4-6-10(9)12/h3-7,11H,8H2,1-2H3 |
| InChIKey | GGLCLJNPFKJCCH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|