C10H11NO — CID 22323517
1-methyl-2,4-dihydroquinolin-3-one (PubChem CID 22323517) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-methyl-2,4-dihydroquinolin-3-one.
| Compound Name | 1-methyl-2,4-dihydroquinolin-3-one |
|---|---|
| PubChem CID | 22323517 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1-methyl-2,4-dihydroquinolin-3-one |
| SMILES | CN1CC(=O)Cc2ccccc21 |
| InChI | InChI=1S/C10H11NO/c1-11-7-9(12)6-8-4-2-3-5-10(8)11/h2-5H,6-7H2,1H3 |
| InChIKey | PIJQKHPEUKEMRD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |