C14H14AsN — CID 22955390
5,10-dimethylphenarsazinine (PubChem CID 22955390) has the molecular formula C14H14AsN and a molecular weight of 271.19 g/mol. Its IUPAC name is 5,10-dimethylphenarsazinine.
| Compound Name | 5,10-dimethylphenarsazinine |
|---|---|
| PubChem CID | 22955390 |
| Molecular Formula | C14H14AsN |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5,10-dimethylphenarsazinine |
| SMILES | CN1c2ccccc2[As](C)c2ccccc21 |
| InChI | InChI=1S/C14H14AsN/c1-15-11-7-3-5-9-13(11)16(2)14-10-6-4-8-12(14)15/h3-10H,1-2H3 |
| InChIKey | CJUNWLYBYQJGPR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|