C31H27IrN2O- — CID 153300411
12-[2,6-di(propan-2-yl)phenyl]-13-phenyl-16-oxa-12,14-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene;iridium (PubChem CID 153300411) has the molecular formula C31H27IrN2O- and a molecular weight of 635.79 g/mol. Its IUPAC name is 12-[2,6-di(propan-2-yl)phenyl]-13-phenyl-16-oxa-12,14-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene;iridium.
| Compound Name | 12-[2,6-di(propan-2-yl)phenyl]-13-phenyl-16-oxa-12,14-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene;iridium |
|---|---|
| PubChem CID | 153300411 |
| Molecular Formula | C31H27IrN2O- |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | 12-[2,6-di(propan-2-yl)phenyl]-13-phenyl-16-oxa-12,14-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15),13-heptaene;iridium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]cccc2)nc2oc3cc4ccccc4cc3c21.[Ir] |
| InChI | InChI=1S/C31H27N2O.Ir/c1-19(2)24-15-10-16-25(20(3)4)28(24)33-29-26-17-22-13-8-9-14-23(22)18-27(26)34-31(29)32-30(33)21-11-6-5-7-12-21;/h5-11,13-20H,1-4H3;/q-1; |
| InChIKey | SARIKOAICCNKGP-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|