C65H58IrN4O-2 — CID 176814873
CID 176814873 (PubChem CID 176814873) has the molecular formula C65H58IrN4O-2 and a molecular weight of 1106.44 g/mol.
| Compound Name | CID 176814873 |
|---|---|
| PubChem CID | 176814873 |
| Molecular Formula | C65H58IrN4O-2 |
| Molecular Weight | 1106.44 g/mol |
| Exact Mass | 1106.44 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[2H]C([2H])([2H])c1c[c-]c(-c2nc3ccccc3n2-c2c(C(C)C)cccc2C(C)C)c2oc3cc4c(ccc5ccccc54)cc3c12.[Ir] |
| InChI | InChI=1S/C40H33N2O.C25H25N2.Ir/c1-23(2)28-13-10-14-29(24(3)4)38(28)42-35-16-9-8-15-34(35)41-40(42)31-20-17-25(5)37-33-21-27-19-18-26-11-6-7-12-30(26)32(27)22-36(33)43-39(31)37;1-17(2)20-13-10-14-21(18(3)4)24(20)27-23-16-9-8-15-22(23)26-25(27)19-11-6-5-7-12-19;/h6-19,21-24H,1-5H3;5-11,13-18H,1-4H3;/q2*-1;/i5D3;; |
| InChIKey | AYZBTZXNTRMXHD-YLSPSJLGSA-N |
| XLogP | 17.99 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.44 |
| LogP ≤ 5 | 17.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|