C20H24NO6Pt- — CID 58401761
[2-[2-(hydroxymethyl)-4,5-dimethoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 58401761) has the molecular formula C20H24NO6Pt- and a molecular weight of 569.49 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)-4,5-dimethoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | [2-[2-(hydroxymethyl)-4,5-dimethoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 58401761 |
| Molecular Formula | C20H24NO6Pt- |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | [2-[2-(hydroxymethyl)-4,5-dimethoxybenzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.COc1[c-]c(-c2cc(CO)ccn2)c(CO)cc1OC.[Pt] |
| InChI | InChI=1S/C15H16NO4.C5H8O2.Pt/c1-19-14-6-11(9-18)12(7-15(14)20-2)13-5-10(8-17)3-4-16-13;1-4(6)3-5(2)7;/h3-6,17-18H,8-9H2,1-2H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | HQFSZSRAVCMXSF-LWFKIUJUSA-N |
| XLogP | 2.59 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|