C22H22NO2Pt- — CID 58401251
[2-[2-(hydroxymethyl)-4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanol;platinum (PubChem CID 58401251) has the molecular formula C22H22NO2Pt- and a molecular weight of 527.50 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)-4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanol;platinum.
| Compound Name | [2-[2-(hydroxymethyl)-4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanol;platinum |
|---|---|
| PubChem CID | 58401251 |
| Molecular Formula | C22H22NO2Pt- |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [2-[2-(hydroxymethyl)-4-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanol;platinum |
| SMILES | Cc1cc(C)c(-c2c[c-]c(-c3cc(CO)ccn3)c(CO)c2)c(C)c1.[Pt] |
| InChI | InChI=1S/C22H22NO2.Pt/c1-14-8-15(2)22(16(3)9-14)18-4-5-20(19(11-18)13-25)21-10-17(12-24)6-7-23-21;/h4,6-11,24-25H,12-13H2,1-3H3;/q-1; |
| InChIKey | VFFCDNOYCBMEJE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|