C18H19F2N2O2Pt- — CID 58401729
1-[2-(3,5-difluorobenzene-6-id-1-yl)-4-pyridinyl]-N-methylmethanamine;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 58401729) has the molecular formula C18H19F2N2O2Pt- and a molecular weight of 528.44 g/mol. Its IUPAC name is 1-[2-(3,5-difluorobenzene-6-id-1-yl)-4-pyridinyl]-N-methylmethanamine;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | 1-[2-(3,5-difluorobenzene-6-id-1-yl)-4-pyridinyl]-N-methylmethanamine;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 58401729 |
| Molecular Formula | C18H19F2N2O2Pt- |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 1-[2-(3,5-difluorobenzene-6-id-1-yl)-4-pyridinyl]-N-methylmethanamine;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.CNCc1ccnc(-c2[c-]c(F)cc(F)c2)c1.[Pt] |
| InChI | InChI=1S/C13H11F2N2.C5H8O2.Pt/c1-16-8-9-2-3-17-13(4-9)10-5-11(14)7-12(15)6-10;1-4(6)3-5(2)7;/h2-5,7,16H,8H2,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | KIGNGPZKFDUJDC-LWFKIUJUSA-N |
| XLogP | 3.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|