C34H33NO3PPt- — CID 156655563
CID 156655563 (PubChem CID 156655563) has the molecular formula C34H33NO3PPt- and a molecular weight of 729.69 g/mol.
| Compound Name | CID 156655563 |
|---|---|
| PubChem CID | 156655563 |
| Molecular Formula | C34H33NO3PPt- |
| Molecular Weight | 729.69 g/mol |
| Exact Mass | 729.19 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.CC1(C)c2[c-]c(-c3ccccn3)cc3c2P(=O)(c2ccccc21)c1ccccc1C3(C)C.[Pt] |
| InChI | InChI=1S/C29H25NOP.C5H8O2.Pt/c1-28(2)20-11-5-7-14-25(20)32(31)26-15-8-6-12-21(26)29(3,4)23-18-19(17-22(28)27(23)32)24-13-9-10-16-30-24;1-4(6)3-5(2)7;/h5-17H,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | PTBDPEIRWTVSOL-LWFKIUJUSA-N |
| XLogP | 6.50 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|