C35H36IrN3O2- — CID 58793146
(Z)-4-hydroxypent-3-en-2-one;iridium;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine (PubChem CID 58793146) has the molecular formula C35H36IrN3O2- and a molecular weight of 722.91 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 58793146 |
| Molecular Formula | C35H36IrN3O2- |
| Molecular Weight | 722.91 g/mol |
| Exact Mass | 723.24 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-N',2-N',7-N',7-N'-tetramethyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine |
| SMILES | CC(=O)/C=C(/C)O.CN(C)c1ccc2c(c1)C1(Cc3c[c-]c(-c4ccccn4)cc3C1)c1cc(N(C)C)ccc1-2.[Ir] |
| InChI | InChI=1S/C30H28N3.C5H8O2.Ir/c1-32(2)23-10-12-25-26-13-11-24(33(3)4)17-28(26)30(27(25)16-23)18-21-9-8-20(15-22(21)19-30)29-7-5-6-14-31-29;1-4(6)3-5(2)7;/h5-7,9-17H,18-19H2,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | CXQWYEFOSQCADU-LWFKIUJUSA-N |
| XLogP | 6.78 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.91 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|