C48H36IrNSi- — CID 58793115
2-(5',5'-dimethyl-2',8'-dinaphthalen-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,10'-benzo[b][1]benzosiline]-5-yl)pyridine;iridium (PubChem CID 58793115) has the molecular formula C48H36IrNSi- and a molecular weight of 847.13 g/mol. Its IUPAC name is 2-(5',5'-dimethyl-2',8'-dinaphthalen-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,10'-benzo[b][1]benzosiline]-5-yl)pyridine;iridium.
| Compound Name | 2-(5',5'-dimethyl-2',8'-dinaphthalen-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,10'-benzo[b][1]benzosiline]-5-yl)pyridine;iridium |
|---|---|
| PubChem CID | 58793115 |
| Molecular Formula | C48H36IrNSi- |
| Molecular Weight | 847.13 g/mol |
| Exact Mass | 847.23 |
| IUPAC Name | 2-(5',5'-dimethyl-2',8'-dinaphthalen-2-ylspiro[3,6-dihydro-1H-inden-6-ide-2,10'-benzo[b][1]benzosiline]-5-yl)pyridine;iridium |
| SMILES | C[Si]1(C)c2ccc(-c3ccc4ccccc4c3)cc2C2(Cc3c[c-]c(-c4ccccn4)cc3C2)c2cc(-c3ccc4ccccc4c3)ccc21.[Ir] |
| InChI | InChI=1S/C48H36NSi.Ir/c1-50(2)46-22-20-38(36-16-14-32-9-3-5-11-34(32)25-36)28-43(46)48(30-41-19-18-40(27-42(41)31-48)45-13-7-8-24-49-45)44-29-39(21-23-47(44)50)37-17-15-33-10-4-6-12-35(33)26-37;/h3-17,19-29H,30-31H2,1-2H3;/q-1; |
| InChIKey | OOJLUGURHKWXOT-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.13 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|