C39H24F6IrN2-2 — CID 58793129
iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-ylpyridine (PubChem CID 58793129) has the molecular formula C39H24F6IrN2-2 and a molecular weight of 826.84 g/mol. Its IUPAC name is iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-ylpyridine.
| Compound Name | iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-ylpyridine |
|---|---|
| PubChem CID | 58793129 |
| Molecular Formula | C39H24F6IrN2-2 |
| Molecular Weight | 826.84 g/mol |
| Exact Mass | 827.15 |
| IUPAC Name | iridium;2-phenyl-4,6-bis(trifluoromethyl)pyridine;2-spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-ylpyridine |
| SMILES | FC(F)(F)c1cc(-c2[c-]cccc2)nc(C(F)(F)F)c1.[Ir].[c-]1cc2c(cc1-c1ccccn1)CC1(C2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H18N.C13H6F6N.Ir/c1-3-9-23-21(7-1)22-8-2-4-10-24(22)26(23)16-19-13-12-18(15-20(19)17-26)25-11-5-6-14-27-25;14-12(15,16)9-6-10(8-4-2-1-3-5-8)20-11(7-9)13(17,18)19;/h1-11,13-15H,16-17H2;1-4,6-7H;/q2*-1; |
| InChIKey | VUBAFQDXAFERPP-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.84 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|