C50H36IrN3- — CID 58793250
iridium;2-N',2-N',7-N',7-N'-tetraphenyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine (PubChem CID 58793250) has the molecular formula C50H36IrN3- and a molecular weight of 871.08 g/mol. Its IUPAC name is iridium;2-N',2-N',7-N',7-N'-tetraphenyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine.
| Compound Name | iridium;2-N',2-N',7-N',7-N'-tetraphenyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 58793250 |
| Molecular Formula | C50H36IrN3- |
| Molecular Weight | 871.08 g/mol |
| Exact Mass | 871.25 |
| IUPAC Name | iridium;2-N',2-N',7-N',7-N'-tetraphenyl-6-pyridin-2-ylspiro[3,5-dihydro-1H-inden-5-ide-2,9'-fluorene]-2',7'-diamine |
| SMILES | [Ir].[c-]1cc2c(cc1-c1ccccn1)CC1(C2)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C50H36N3.Ir/c1-5-15-39(16-6-1)52(40-17-7-2-8-18-40)43-26-28-45-46-29-27-44(53(41-19-9-3-10-20-41)42-21-11-4-12-22-42)33-48(46)50(47(45)32-43)34-37-25-24-36(31-38(37)35-50)49-23-13-14-30-51-49;/h1-23,25-33H,34-35H2;/q-1; |
| InChIKey | CMOQUOCPXYMEKE-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.08 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|