C24H19IrN2- — CID 140595043
iridium;N-(4-methylphenyl)-N-phenyl-3-pyridin-2-ylbenzene-4-id-1-amine (PubChem CID 140595043) has the molecular formula C24H19IrN2- and a molecular weight of 527.65 g/mol. Its IUPAC name is iridium;N-(4-methylphenyl)-N-phenyl-3-pyridin-2-ylbenzene-4-id-1-amine.
| Compound Name | iridium;N-(4-methylphenyl)-N-phenyl-3-pyridin-2-ylbenzene-4-id-1-amine |
|---|---|
| PubChem CID | 140595043 |
| Molecular Formula | C24H19IrN2- |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | iridium;N-(4-methylphenyl)-N-phenyl-3-pyridin-2-ylbenzene-4-id-1-amine |
| SMILES | Cc1ccc(N(c2ccccc2)c2cc[c-]c(-c3ccccn3)c2)cc1.[Ir] |
| InChI | InChI=1S/C24H19N2.Ir/c1-19-13-15-22(16-14-19)26(21-9-3-2-4-10-21)23-11-7-8-20(18-23)24-12-5-6-17-25-24;/h2-7,9-18H,1H3;/q-1; |
| InChIKey | RVVJGIOCDBZZAP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|