C17H22IrNP — CID 59782033
iridium;triethyl-(3-pyridin-2-ylbenzene-4-id-1-yl)phosphanium (PubChem CID 59782033) has the molecular formula C17H22IrNP and a molecular weight of 463.56 g/mol. Its IUPAC name is iridium;triethyl-(3-pyridin-2-ylbenzene-4-id-1-yl)phosphanium.
| Compound Name | iridium;triethyl-(3-pyridin-2-ylbenzene-4-id-1-yl)phosphanium |
|---|---|
| PubChem CID | 59782033 |
| Molecular Formula | C17H22IrNP |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | iridium;triethyl-(3-pyridin-2-ylbenzene-4-id-1-yl)phosphanium |
| SMILES | CC[P+](CC)(CC)c1cc[c-]c(-c2ccccn2)c1.[Ir] |
| InChI | InChI=1S/C17H22NP.Ir/c1-4-19(5-2,6-3)16-11-9-10-15(14-16)17-12-7-8-13-18-17;/h7-9,11-14H,4-6H2,1-3H3; |
| InChIKey | JMXKNOXYAKHNKJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|