C72H66IrN4O4-2 — CID 139253797
bis(9,9-diethyl-N,N-bis(4-methoxyphenyl)-7-pyridin-2-yl-6H-fluoren-6-id-2-amine);iridium (PubChem CID 139253797) has the molecular formula C72H66IrN4O4-2 and a molecular weight of 1243.56 g/mol. Its IUPAC name is bis(9,9-diethyl-N,N-bis(4-methoxyphenyl)-7-pyridin-2-yl-6H-fluoren-6-id-2-amine);iridium.
| Compound Name | bis(9,9-diethyl-N,N-bis(4-methoxyphenyl)-7-pyridin-2-yl-6H-fluoren-6-id-2-amine);iridium |
|---|---|
| PubChem CID | 139253797 |
| Molecular Formula | C72H66IrN4O4-2 |
| Molecular Weight | 1243.56 g/mol |
| Exact Mass | 1243.47 |
| IUPAC Name | bis(9,9-diethyl-N,N-bis(4-methoxyphenyl)-7-pyridin-2-yl-6H-fluoren-6-id-2-amine);iridium |
| SMILES | CCC1(CC)c2cc(-c3ccccn3)[c-]cc2-c2ccc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)cc21.CCC1(CC)c2cc(-c3ccccn3)[c-]cc2-c2ccc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)cc21.[Ir] |
| InChI | InChI=1S/2C36H33N2O2.Ir/c2*1-5-36(6-2)33-23-25(35-9-7-8-22-37-35)10-20-31(33)32-21-15-28(24-34(32)36)38(26-11-16-29(39-3)17-12-26)27-13-18-30(40-4)19-14-27;/h2*7-9,11-24H,5-6H2,1-4H3;/q2*-1; |
| InChIKey | KZCALZLLXRZUCV-UHFFFAOYSA-N |
| XLogP | 18.24 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1243.56 |
| LogP ≤ 5 | 18.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|