C28H22Cl2IrN — CID 58793209
dichloroiridium(1+);2-(2',7'-dimethylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine (PubChem CID 58793209) has the molecular formula C28H22Cl2IrN and a molecular weight of 635.61 g/mol. Its IUPAC name is dichloroiridium(1+);2-(2',7'-dimethylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine.
| Compound Name | dichloroiridium(1+);2-(2',7'-dimethylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine |
|---|---|
| PubChem CID | 58793209 |
| Molecular Formula | C28H22Cl2IrN |
| Molecular Weight | 635.61 g/mol |
| Exact Mass | 635.08 |
| IUPAC Name | dichloroiridium(1+);2-(2',7'-dimethylspiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl)pyridine |
| SMILES | Cc1ccc2c(c1)C1(Cc3c[c-]c(-c4ccccn4)cc3C1)c1cc(C)ccc1-2.Cl[Ir+]Cl |
| InChI | InChI=1S/C28H22N.2ClH.Ir/c1-18-6-10-23-24-11-7-19(2)14-26(24)28(25(23)13-18)16-21-9-8-20(15-22(21)17-28)27-5-3-4-12-29-27;;;/h3-7,9-15H,16-17H2,1-2H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | KSBWSCDICUQLBC-UHFFFAOYSA-L |
| XLogP | 7.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.61 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|