C29H26NOP — CID 156655217
8,8,14,14-tetramethyl-11-pyridin-2-yl-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide (PubChem CID 156655217) has the molecular formula C29H26NOP and a molecular weight of 435.51 g/mol. Its IUPAC name is 8,8,14,14-tetramethyl-11-pyridin-2-yl-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide.
| Compound Name | 8,8,14,14-tetramethyl-11-pyridin-2-yl-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide |
|---|---|
| PubChem CID | 156655217 |
| Molecular Formula | C29H26NOP |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 8,8,14,14-tetramethyl-11-pyridin-2-yl-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide |
| SMILES | CC1(C)c2ccccc2P2(=O)c3ccccc3C(C)(C)c3cc(-c4ccccn4)cc1c32 |
| InChI | InChI=1S/C29H26NOP/c1-28(2)20-11-5-7-14-25(20)32(31)26-15-8-6-12-21(26)29(3,4)23-18-19(17-22(28)27(23)32)24-13-9-10-16-30-24/h5-18H,1-4H3 |
| InChIKey | PRTGOBKAALXHCU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|