C49H37N5 — CID 122415950
2,4-bis(9,9-dimethylfluoren-1-yl)-6-(3,5-dipyridin-2-ylphenyl)-1,3,5-triazine (PubChem CID 122415950) has the molecular formula C49H37N5 and a molecular weight of 695.87 g/mol. Its IUPAC name is 2,4-bis(9,9-dimethylfluoren-1-yl)-6-(3,5-dipyridin-2-ylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(9,9-dimethylfluoren-1-yl)-6-(3,5-dipyridin-2-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 122415950 |
| Molecular Formula | C49H37N5 |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.30 |
| IUPAC Name | 2,4-bis(9,9-dimethylfluoren-1-yl)-6-(3,5-dipyridin-2-ylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3nc(-c4cc(-c5ccccn5)cc(-c5ccccn5)c4)nc(-c4cccc5c4C(C)(C)c4ccccc4-5)n3)c21 |
| InChI | InChI=1S/C49H37N5/c1-48(2)39-21-7-5-15-33(39)35-17-13-19-37(43(35)48)46-52-45(32-28-30(41-23-9-11-25-50-41)27-31(29-32)42-24-10-12-26-51-42)53-47(54-46)38-20-14-18-36-34-16-6-8-22-40(34)49(3,4)44(36)38/h5-29H,1-4H3 |
| InChIKey | RTRRVSCRNKVIDB-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |