About CID 156655248
CID 156655248 (PubChem CID 156655248) has the molecular formula C28H21IrNO4PS-
and a molecular weight of 690.74 g/mol.
Molecular Properties
| Compound Name | CID 156655248 |
| PubChem CID | 156655248 |
| Molecular Formula | C28H21IrNO4PS- |
| Molecular Weight | 690.74 g/mol |
| Exact Mass | 691.06 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)O.S=P12c3ccccc3Oc3[c-]c(-c4ccccn4)cc(c31)Oc1ccccc12.[Ir] |
| InChI | InChI=1S/C23H13NO2PS.C5H8O2.Ir/c28-27-21-10-3-1-8-17(21)25-19-13-15(16-7-5-6-12-24-16)14-20(23(19)27)26-18-9-2-4-11-22(18)27;1-4(6)3-5(2)7;/h1-13H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | IFBRXYQTBHCYJV-LWFKIUJUSA-N |
| XLogP | 5.55 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 690.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 156655248 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156655248?
The IUPAC name of CID 156655248 (CID 156655248) is not available.
What is the SMILES notation for CID 156655248?
The canonical SMILES for CID 156655248 is CC(=O)/C=C(/C)O.S=P12c3ccccc3Oc3[c-]c(-c4ccccn4)cc(c31)Oc1ccccc12.[Ir].
What is the InChIKey of CID 156655248?
The InChIKey is IFBRXYQTBHCYJV-LWFKIUJUSA-N. The full InChI is InChI=1S/C23H13NO2PS.C5H8O2.Ir/c28-27-21-10-3-1-8-17(21)25-19-13-15(16-7-5-6-12-24-16)14-20(23(19)27)26-18-9-2-4-11-22(18)27;1-4(6)3-5(2)7;/h1-13H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of CID 156655248?
CID 156655248 has a molecular weight of 690.74 g/mol, XLogP of 5.55, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156655248 is sourced from PubChem (CID 156655248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).